C26H32N4O3S3 — CID 67490133
N-(2-ethoxyethyl)-N-[2-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide (PubChem CID 67490133) has the molecular formula C26H32N4O3S3 and a molecular weight of 544.77 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-[2-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-N-[2-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67490133 |
| Molecular Formula | C26H32N4O3S3 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | N-(2-ethoxyethyl)-N-[2-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1H-indol-7-yl]thiophene-2-sulfonamide |
| SMILES | CCOCCN(c1cccc2cc(-c3ncc(CN4CCCCC4C)s3)[nH]c12)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C26H32N4O3S3/c1-3-33-14-13-30(36(31,32)24-11-7-15-34-24)23-10-6-9-20-16-22(28-25(20)23)26-27-17-21(35-26)18-29-12-5-4-8-19(29)2/h6-7,9-11,15-17,19,28H,3-5,8,12-14,18H2,1-2H3 |
| InChIKey | GQMCGIDYSSYXTR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|