C7H14N2 — CID 67490790
(3aS,6aR)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine (PubChem CID 67490790) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (3aS,6aR)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine.
| Compound Name | (3aS,6aR)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine |
|---|---|
| PubChem CID | 67490790 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (3aS,6aR)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3a-amine |
| SMILES | N[C@@]12CCC[C@@H]1CNC2 |
| InChI | InChI=1S/C7H14N2/c8-7-3-1-2-6(7)4-9-5-7/h6,9H,1-5,8H2/t6-,7-/m1/s1 |
| InChIKey | TUYIHOJSSJJFMO-RNFRBKRXSA-N |
| XLogP | 0.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |