C20H28N2O5 — CID 67490817
benzyl (3aS,7aR)-3a-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxylate (PubChem CID 67490817) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is benzyl (3aS,7aR)-3a-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxylate.
| Compound Name | benzyl (3aS,7aR)-3a-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67490817 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | benzyl (3aS,7aR)-3a-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@]12COCC[C@@H]1CN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C20H28N2O5/c1-19(2,3)27-17(23)21-20-13-22(11-16(20)9-10-25-14-20)18(24)26-12-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3,(H,21,23)/t16-,20+/m1/s1 |
| InChIKey | SJSODQQFULMMML-UZLBHIALSA-N |
| XLogP | 2.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |