C20H25NO4 — CID 67490991
3-O-benzyl 1-O-tert-butyl (1S,5S)-6-methylidene-3-azabicyclo[3.2.0]heptane-1,3-dicarboxylate (PubChem CID 67490991) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl (1S,5S)-6-methylidene-3-azabicyclo[3.2.0]heptane-1,3-dicarboxylate.
| Compound Name | 3-O-benzyl 1-O-tert-butyl (1S,5S)-6-methylidene-3-azabicyclo[3.2.0]heptane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 67490991 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl (1S,5S)-6-methylidene-3-azabicyclo[3.2.0]heptane-1,3-dicarboxylate |
| SMILES | C=C1C[C@@]2(C(=O)OC(C)(C)C)CN(C(=O)OCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C20H25NO4/c1-14-10-20(17(22)25-19(2,3)4)13-21(11-16(14)20)18(23)24-12-15-8-6-5-7-9-15/h5-9,16H,1,10-13H2,2-4H3/t16-,20+/m0/s1 |
| InChIKey | FLGFDPWDVSCRRM-OXJNMPFZSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|