C20H26FNO3 — CID 67491013
tert-butyl (3aR,4R,6aS)-4-fluoro-3-oxo-2-[(1R)-1-phenylethyl]-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxylate (PubChem CID 67491013) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6aS)-4-fluoro-3-oxo-2-[(1R)-1-phenylethyl]-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6aS)-4-fluoro-3-oxo-2-[(1R)-1-phenylethyl]-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 67491013 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | tert-butyl (3aR,4R,6aS)-4-fluoro-3-oxo-2-[(1R)-1-phenylethyl]-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@]2(C(=O)OC(C)(C)C)CC[C@@H](F)[C@H]2C1=O |
| InChI | InChI=1S/C20H26FNO3/c1-13(14-8-6-5-7-9-14)22-12-20(18(24)25-19(2,3)4)11-10-15(21)16(20)17(22)23/h5-9,13,15-16H,10-12H2,1-4H3/t13-,15-,16+,20-/m1/s1 |
| InChIKey | GUCAGGUIZVZJGB-BCEDRHLLSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |