C8H14N4 — CID 67491434
cis-(1R,3S)-3-(1,2,4-triazol-4-yl)cyclohexan-1-amine (PubChem CID 67491434) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is cis-(1R,3S)-3-(1,2,4-triazol-4-yl)cyclohexan-1-amine.
| Compound Name | cis-(1R,3S)-3-(1,2,4-triazol-4-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 67491434 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | cis-(1R,3S)-3-(1,2,4-triazol-4-yl)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCC[C@H](n2cnnc2)C1 |
| InChI | InChI=1S/C8H14N4/c9-7-2-1-3-8(4-7)12-5-10-11-6-12/h5-8H,1-4,9H2/t7-,8+/m1/s1 |
| InChIKey | WNWTWTCJBALFSN-SFYZADRCSA-N |
| XLogP | 0.72 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |