C20H23F3N4O — CID 67491572
2,3,5-trifluoro-N-[(3-methylphenyl)methylideneamino]-6-(2-piperidin-1-ylethoxy)pyridin-4-amine (PubChem CID 67491572) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-[(3-methylphenyl)methylideneamino]-6-(2-piperidin-1-ylethoxy)pyridin-4-amine.
| Compound Name | 2,3,5-trifluoro-N-[(3-methylphenyl)methylideneamino]-6-(2-piperidin-1-ylethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 67491572 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2,3,5-trifluoro-N-[(3-methylphenyl)methylideneamino]-6-(2-piperidin-1-ylethoxy)pyridin-4-amine |
| SMILES | Cc1cccc(C=NNc2c(F)c(F)nc(OCCN3CCCCC3)c2F)c1 |
| InChI | InChI=1S/C20H23F3N4O/c1-14-6-5-7-15(12-14)13-24-26-18-16(21)19(23)25-20(17(18)22)28-11-10-27-8-3-2-4-9-27/h5-7,12-13H,2-4,8-11H2,1H3,(H,25,26) |
| InChIKey | JCCOOCXKSZQDNV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|