C21H20N4O — CID 67492019
5-methoxy-2,3,12,13,22,24-hexahydroporphyrin (PubChem CID 67492019) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-methoxy-2,3,12,13,22,24-hexahydroporphyrin.
| Compound Name | 5-methoxy-2,3,12,13,22,24-hexahydroporphyrin |
|---|---|
| PubChem CID | 67492019 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-methoxy-2,3,12,13,22,24-hexahydroporphyrin |
| SMILES | COc1c2nc(cc3ccc(cc4nc(cc5ccc1[nH]5)CC4)[nH]3)CC2 |
| InChI | InChI=1S/C21H20N4O/c1-26-21-19-8-6-17(24-19)11-15-4-2-13(22-15)10-14-3-5-16(23-14)12-18-7-9-20(21)25-18/h2,4,7,9-12,22,25H,3,5-6,8H2,1H3/b13-10-,14-10-,15-11-,16-12-,17-11-,18-12-,21-19+,21-20+ |
| InChIKey | WAZMKTOGUWALNV-YJHYENFXSA-N |
| XLogP | 3.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |