C12H11ClN2O3 — CID 67492155
6-chloro-5-[(3-methoxyphenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 67492155) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 6-chloro-5-[(3-methoxyphenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-[(3-methoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67492155 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 6-chloro-5-[(3-methoxyphenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1cccc(Cc2c(Cl)[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-18-8-4-2-3-7(5-8)6-9-10(13)14-12(17)15-11(9)16/h2-5H,6H2,1H3,(H2,14,15,16,17) |
| InChIKey | WWABQJQYDHIBIN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |