C14H18N2O3 — CID 67492357
1-[(7S,9R)-9-amino-7-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-6-yl]ethanone (PubChem CID 67492357) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[(7S,9R)-9-amino-7-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-6-yl]ethanone.
| Compound Name | 1-[(7S,9R)-9-amino-7-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-6-yl]ethanone |
|---|---|
| PubChem CID | 67492357 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-[(7S,9R)-9-amino-7-methyl-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-6-yl]ethanone |
| SMILES | CC(=O)N1c2cc3c(cc2[C@H](N)C[C@@H]1C)OCCO3 |
| InChI | InChI=1S/C14H18N2O3/c1-8-5-11(15)10-6-13-14(19-4-3-18-13)7-12(10)16(8)9(2)17/h6-8,11H,3-5,15H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | WPVPMLCNCLKRSK-GZMMTYOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |