C7H15ClN2O — CID 67492380
2-(1-methylpyrrolidin-2-yl)acetamide;hydrochloride (PubChem CID 67492380) has the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67492380 |
| Molecular Formula | C7H15ClN2O |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)acetamide;hydrochloride |
| SMILES | CN1CCCC1CC(N)=O.Cl |
| InChI | InChI=1S/C7H14N2O.ClH/c1-9-4-2-3-6(9)5-7(8)10;/h6H,2-5H2,1H3,(H2,8,10);1H |
| InChIKey | ZCZTXZHVRIHVHF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |