C36H36F2N4O2 — CID 67492664
4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]but-3-enyl]-2,6-difluorophenol (PubChem CID 67492664) has the molecular formula C36H36F2N4O2 and a molecular weight of 594.71 g/mol. Its IUPAC name is 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]but-3-enyl]-2,6-difluorophenol.
| Compound Name | 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]but-3-enyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 67492664 |
| Molecular Formula | C36H36F2N4O2 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]but-3-enyl]-2,6-difluorophenol |
| SMILES | C=CC(CCc1ccc(-c2nn[nH]n2)cc1)C(c1cc(F)c(O)c(F)c1)c1ccccc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H36F2N4O2/c1-5-25(15-10-23-11-16-26(17-12-23)35-39-41-42-40-35)33(27-20-30(37)34(43)31(38)21-27)29-8-6-7-9-32(29)44-22-24-13-18-28(19-14-24)36(2,3)4/h5-9,11-14,16-21,25,33,43H,1,10,15,22H2,2-4H3,(H,39,40,41,42) |
| InChIKey | ZLUVZABOERGUGB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|