About 4H-chromene-4,7-diol
4H-chromene-4,7-diol (PubChem CID 67492967) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 4H-chromene-4,7-diol.
Molecular Properties
| Compound Name | 4H-chromene-4,7-diol |
| PubChem CID | 67492967 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 4H-chromene-4,7-diol |
| SMILES | Oc1ccc2c(c1)OC=CC2O |
| InChI | InChI=1S/C9H8O3/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5,8,10-11H |
| InChIKey | VLMKDRZVPRRPAW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-chromene-4,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-chromene-4,7-diol?
The IUPAC name of 4H-chromene-4,7-diol (CID 67492967) is 4H-chromene-4,7-diol.
What is the SMILES notation for 4H-chromene-4,7-diol?
The canonical SMILES for 4H-chromene-4,7-diol is Oc1ccc2c(c1)OC=CC2O.
What is the InChIKey of 4H-chromene-4,7-diol?
The InChIKey is VLMKDRZVPRRPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5,8,10-11H.
What are the key properties of 4H-chromene-4,7-diol?
4H-chromene-4,7-diol has a molecular weight of 164.16 g/mol, XLogP of 1.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-chromene-4,7-diol is sourced from PubChem (CID 67492967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).