C22H36BNO4 — CID 67493007
tert-butyl N-methyl-N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate (PubChem CID 67493007) has the molecular formula C22H36BNO4 and a molecular weight of 389.35 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 67493007 |
| Molecular Formula | C22H36BNO4 |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butyl]carbamate |
| SMILES | CCC(CN(C)C(=O)OC(C)(C)C)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H36BNO4/c1-10-16(15-24(9)19(25)26-20(2,3)4)17-12-11-13-18(14-17)23-27-21(5,6)22(7,8)28-23/h11-14,16H,10,15H2,1-9H3 |
| InChIKey | LYITUNTYKQFYRT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|