C23H24N2O3 — CID 67493029
3-[(4-methylpiperidin-1-yl)methyl]-1-oxo-2-phenylisoquinoline-4-carboxylic acid (PubChem CID 67493029) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[(4-methylpiperidin-1-yl)methyl]-1-oxo-2-phenylisoquinoline-4-carboxylic acid.
| Compound Name | 3-[(4-methylpiperidin-1-yl)methyl]-1-oxo-2-phenylisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 67493029 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[(4-methylpiperidin-1-yl)methyl]-1-oxo-2-phenylisoquinoline-4-carboxylic acid |
| SMILES | CC1CCN(Cc2c(C(=O)O)c3ccccc3c(=O)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O3/c1-16-11-13-24(14-12-16)15-20-21(23(27)28)18-9-5-6-10-19(18)22(26)25(20)17-7-3-2-4-8-17/h2-10,16H,11-15H2,1H3,(H,27,28) |
| InChIKey | OTYIKKGIKOHVOL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |