C31H48N2O3 — CID 67493435
tert-butyl 4-docosa-4,7,10,13,16,19-hexaenoylpiperazine-1-carboxylate (PubChem CID 67493435) has the molecular formula C31H48N2O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is tert-butyl 4-docosa-4,7,10,13,16,19-hexaenoylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-docosa-4,7,10,13,16,19-hexaenoylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 67493435 |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | tert-butyl 4-docosa-4,7,10,13,16,19-hexaenoylpiperazine-1-carboxylate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H48N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29(34)32-25-27-33(28-26-32)30(35)36-31(2,3)4/h6-7,9-10,12-13,15-16,18-19,21-22H,5,8,11,14,17,20,23-28H2,1-4H3 |
| InChIKey | HJABFSFFKNKZLT-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|