C22H20F3N5O4S — CID 67493600
2-N-[5-(3,5-difluorophenyl)sulfonyl-7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridin-3-yl]-3-fluorobenzene-1,2-dicarboxamide (PubChem CID 67493600) has the molecular formula C22H20F3N5O4S and a molecular weight of 507.49 g/mol. Its IUPAC name is 2-N-[5-(3,5-difluorophenyl)sulfonyl-7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridin-3-yl]-3-fluorobenzene-1,2-dicarboxamide.
| Compound Name | 2-N-[5-(3,5-difluorophenyl)sulfonyl-7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridin-3-yl]-3-fluorobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 67493600 |
| Molecular Formula | C22H20F3N5O4S |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-N-[5-(3,5-difluorophenyl)sulfonyl-7,7-dimethyl-4,6-dihydro-1H-pyrazolo[4,5-c]pyridin-3-yl]-3-fluorobenzene-1,2-dicarboxamide |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc(F)cc(F)c2)Cc2c(NC(=O)c3c(F)cccc3C(N)=O)n[nH]c21 |
| InChI | InChI=1S/C22H20F3N5O4S/c1-22(2)10-30(35(33,34)13-7-11(23)6-12(24)8-13)9-15-18(22)28-29-20(15)27-21(32)17-14(19(26)31)4-3-5-16(17)25/h3-8H,9-10H2,1-2H3,(H2,26,31)(H2,27,28,29,32) |
| InChIKey | PLTLRMCPPJLWPF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |