C21H22F2N6O3S — CID 67493798
2-amino-N-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-4-(dimethylamino)benzamide (PubChem CID 67493798) has the molecular formula C21H22F2N6O3S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-amino-N-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-4-(dimethylamino)benzamide.
| Compound Name | 2-amino-N-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 67493798 |
| Molecular Formula | C21H22F2N6O3S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-amino-N-[5-(3,5-difluorophenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2n[nH]c3c2CN(S(=O)(=O)c2cc(F)cc(F)c2)CC3)c(N)c1 |
| InChI | InChI=1S/C21H22F2N6O3S/c1-28(2)14-3-4-16(18(24)10-14)21(30)25-20-17-11-29(6-5-19(17)26-27-20)33(31,32)15-8-12(22)7-13(23)9-15/h3-4,7-10H,5-6,11,24H2,1-2H3,(H2,25,26,27,30) |
| InChIKey | ICLFOFRHJDNESY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|