2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid

C12H10N2O4 — CID 67494015

IUPAC2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid
SMILESO=C(O)C1(C(=O)O)C=CC(c2ccccn2)N=C1
InChIInChI=1S/C12H10N2O4/c15-10(16)12(11(17)18)5-4-9(14-7-12)8-3-1-2-6-13-8/h1-7,9H,(H,15,16)(H,17,18)
InChIKeySALUUJTUIKZGLN-UHFFFAOYSA-N
MW246.22 g/mol
LogP0.92
Rot. Bonds3

About 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid

2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid (PubChem CID 67494015) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid.

Molecular Properties

Compound Name2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid
PubChem CID67494015
Molecular FormulaC12H10N2O4
Molecular Weight246.22 g/mol
Exact Mass246.06
IUPAC Name2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid
SMILESO=C(O)C1(C(=O)O)C=CC(c2ccccn2)N=C1
InChIInChI=1S/C12H10N2O4/c15-10(16)12(11(17)18)5-4-9(14-7-12)8-3-1-2-6-13-8/h1-7,9H,(H,15,16)(H,17,18)
InChIKeySALUUJTUIKZGLN-UHFFFAOYSA-N
XLogP0.92
TPSA99.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.22
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid?
The IUPAC name of 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid (CID 67494015) is 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid.
What is the SMILES notation for 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid?
The canonical SMILES for 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid is O=C(O)C1(C(=O)O)C=CC(c2ccccn2)N=C1.
What is the InChIKey of 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid?
The InChIKey is SALUUJTUIKZGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4/c15-10(16)12(11(17)18)5-4-9(14-7-12)8-3-1-2-6-13-8/h1-7,9H,(H,15,16)(H,17,18).
What are the key properties of 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid?
2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid has a molecular weight of 246.22 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-2H-pyridine-5,5-dicarboxylic acid is sourced from PubChem (CID 67494015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).