About 5-amino-1,3-diazinan-4-one
5-amino-1,3-diazinan-4-one (PubChem CID 67494237) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is 5-amino-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 5-amino-1,3-diazinan-4-one |
| PubChem CID | 67494237 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 5-amino-1,3-diazinan-4-one |
| SMILES | NC1CNCNC1=O |
| InChI | InChI=1S/C4H9N3O/c5-3-1-6-2-7-4(3)8/h3,6H,1-2,5H2,(H,7,8) |
| InChIKey | SWYAYSOLQYDJNT-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-diazinan-4-one?
The IUPAC name of 5-amino-1,3-diazinan-4-one (CID 67494237) is 5-amino-1,3-diazinan-4-one.
What is the SMILES notation for 5-amino-1,3-diazinan-4-one?
The canonical SMILES for 5-amino-1,3-diazinan-4-one is NC1CNCNC1=O.
What is the InChIKey of 5-amino-1,3-diazinan-4-one?
The InChIKey is SWYAYSOLQYDJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O/c5-3-1-6-2-7-4(3)8/h3,6H,1-2,5H2,(H,7,8).
What are the key properties of 5-amino-1,3-diazinan-4-one?
5-amino-1,3-diazinan-4-one has a molecular weight of 115.14 g/mol, XLogP of -2.01, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-diazinan-4-one is sourced from PubChem (CID 67494237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).