C42H64N6O6Si2 — CID 67494377
ditert-butyl 5-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1,2-dicarboxylate (PubChem CID 67494377) has the molecular formula C42H64N6O6Si2 and a molecular weight of 805.18 g/mol. Its IUPAC name is ditert-butyl 5-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 5-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67494377 |
| Molecular Formula | C42H64N6O6Si2 |
| Molecular Weight | 805.18 g/mol |
| Exact Mass | 804.44 |
| IUPAC Name | ditert-butyl 5-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc5ccccc5c4)c3n2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H64N6O6Si2/c1-41(2,3)53-39(49)36-18-17-31(27-47(36)40(50)54-42(4,5)6)35-24-37(46(28-51-19-21-55(7,8)9)29-52-20-22-56(10,11)12)48-38(45-35)33(26-44-48)32-23-30-15-13-14-16-34(30)43-25-32/h13-16,23-26,31,36H,17-22,27-29H2,1-12H3 |
| InChIKey | USRFYRMDSGYOKA-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 120.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.18 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|