C29H49FN4O4Si2 — CID 67494474
ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate (PubChem CID 67494474) has the molecular formula C29H49FN4O4Si2 and a molecular weight of 592.91 g/mol. Its IUPAC name is ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate.
| Compound Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 67494474 |
| Molecular Formula | C29H49FN4O4Si2 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1(F)CC12CCC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3nccc3n1)CC2 |
| InChI | InChI=1S/C29H49FN4O4Si2/c1-8-38-27(35)29(30)20-28(29)12-9-23(10-13-28)24-19-26(34-25(32-24)11-14-31-34)33(21-36-15-17-39(2,3)4)22-37-16-18-40(5,6)7/h11,14,19,23H,8-10,12-13,15-18,20-22H2,1-7H3 |
| InChIKey | QPKLEOXKYQESTH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|