C40H56FN7O2Si2 — CID 67494484
5-N-[(1-benzylpiperidin-4-yl)methyl]-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 67494484) has the molecular formula C40H56FN7O2Si2 and a molecular weight of 742.11 g/mol. Its IUPAC name is 5-N-[(1-benzylpiperidin-4-yl)methyl]-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 5-N-[(1-benzylpiperidin-4-yl)methyl]-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 67494484 |
| Molecular Formula | C40H56FN7O2Si2 |
| Molecular Weight | 742.11 g/mol |
| Exact Mass | 741.40 |
| IUPAC Name | 5-N-[(1-benzylpiperidin-4-yl)methyl]-3-(6-fluoroquinolin-3-yl)-7-N,7-N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(NCC2CCN(Cc3ccccc3)CC2)nc2c(-c3cnc4ccc(F)cc4c3)cnn12 |
| InChI | InChI=1S/C40H56FN7O2Si2/c1-51(2,3)20-18-49-29-47(30-50-19-21-52(4,5)6)39-24-38(43-25-31-14-16-46(17-15-31)28-32-10-8-7-9-11-32)45-40-36(27-44-48(39)40)34-22-33-23-35(41)12-13-37(33)42-26-34/h7-13,22-24,26-27,31H,14-21,25,28-30H2,1-6H3,(H,43,45) |
| InChIKey | PESCEGVMOJVRRA-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.11 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|