C41H60N6O5Si2 — CID 67494585
tert-butyl 4-[6-acetyl-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 67494585) has the molecular formula C41H60N6O5Si2 and a molecular weight of 773.14 g/mol. Its IUPAC name is tert-butyl 4-[6-acetyl-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-acetyl-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67494585 |
| Molecular Formula | C41H60N6O5Si2 |
| Molecular Weight | 773.14 g/mol |
| Exact Mass | 772.42 |
| IUPAC Name | tert-butyl 4-[6-acetyl-7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | CC(=O)c1c(C2CCN(C(=O)OC(C)(C)C)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C41H60N6O5Si2/c1-30(48)36-37(32-18-20-45(21-19-32)40(49)52-41(2,3)4)44-38-34(33-16-17-35(42-26-33)31-14-12-11-13-15-31)27-43-47(38)39(36)46(28-50-22-24-53(5,6)7)29-51-23-25-54(8,9)10/h11-17,26-27,32H,18-25,28-29H2,1-10H3 |
| InChIKey | FMRAHRFSJMQJEN-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 111.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.14 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|