C23H35N3O4 — CID 67495407
methyl 3-[[(1S,2R,3R,4R)-3-(4-pyrrolidin-1-ylbutylcarbamoyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propanoate (PubChem CID 67495407) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is methyl 3-[[(1S,2R,3R,4R)-3-(4-pyrrolidin-1-ylbutylcarbamoyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(1S,2R,3R,4R)-3-(4-pyrrolidin-1-ylbutylcarbamoyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67495407 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | methyl 3-[[(1S,2R,3R,4R)-3-(4-pyrrolidin-1-ylbutylcarbamoyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@H]1[C@H](C(=O)NCCCCN2CCCC2)[C@H]2C=C[C@@H]1C21CC1 |
| InChI | InChI=1S/C23H35N3O4/c1-30-18(27)8-12-25-22(29)20-17-7-6-16(23(17)9-10-23)19(20)21(28)24-11-2-3-13-26-14-4-5-15-26/h6-7,16-17,19-20H,2-5,8-15H2,1H3,(H,24,28)(H,25,29)/t16-,17+,19-,20-/m1/s1 |
| InChIKey | LTXRBAGUQVLJBQ-PIKOESSRSA-N |
| XLogP | 1.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|