C24H30Cl2N2O2 — CID 67495537
2,6-dichloro-N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)benzohydrazide (PubChem CID 67495537) has the molecular formula C24H30Cl2N2O2 and a molecular weight of 449.42 g/mol. Its IUPAC name is 2,6-dichloro-N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)benzohydrazide.
| Compound Name | 2,6-dichloro-N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 67495537 |
| Molecular Formula | C24H30Cl2N2O2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2,6-dichloro-N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)benzohydrazide |
| SMILES | CCCC(N(NC(=O)c1c(Cl)cccc1Cl)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H30Cl2N2O2/c1-7-9-20(24(4,5)6)28(23(30)17-13-15(2)12-16(3)14-17)27-22(29)21-18(25)10-8-11-19(21)26/h8,10-14,20H,7,9H2,1-6H3,(H,27,29) |
| InChIKey | ZQOVRMHKQPFDIP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|