C22H28BrN3O2 — CID 67495547
(1R,2R,3R,4S)-2-N-(5-aminopentyl)-3-N-(4-bromophenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495547) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-N-(5-aminopentyl)-3-N-(4-bromophenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-2-N-(5-aminopentyl)-3-N-(4-bromophenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495547 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (1R,2R,3R,4S)-2-N-(5-aminopentyl)-3-N-(4-bromophenyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | NCCCCCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C22H28BrN3O2/c23-14-4-6-15(7-5-14)26-21(28)19-17-9-8-16(22(17)10-11-22)18(19)20(27)25-13-3-1-2-12-24/h4-9,16-19H,1-3,10-13,24H2,(H,25,27)(H,26,28)/t16-,17+,18-,19-/m1/s1 |
| InChIKey | PYKQFMTWCSFAKN-FCGDIQPGSA-N |
| XLogP | 3.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|