C23H37N3O2 — CID 67495594
(1S,2R,3R,4R)-2-N-butyl-3-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495594) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-N-butyl-3-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-N-butyl-3-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495594 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | (1S,2R,3R,4R)-2-N-butyl-3-N-(4-pyrrolidin-1-ylbutyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CCCCNC(=O)[C@H]1[C@H](C(=O)NCCCCN2CCCC2)[C@H]2C=C[C@@H]1C21CC1 |
| InChI | InChI=1S/C23H37N3O2/c1-2-3-12-24-21(27)19-17-8-9-18(23(17)10-11-23)20(19)22(28)25-13-4-5-14-26-15-6-7-16-26/h8-9,17-20H,2-7,10-16H2,1H3,(H,24,27)(H,25,28)/t17-,18+,19+,20+/m0/s1 |
| InChIKey | YDGLHCZRCYMSLI-MTQWCTHYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|