C24H34BrN3O2 — CID 67495611
(1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495611) has the molecular formula C24H34BrN3O2 and a molecular weight of 476.46 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495611 |
| Molecular Formula | C24H34BrN3O2 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CN(C)CCCCCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2CC[C@H]1C21CC1 |
| InChI | InChI=1S/C24H34BrN3O2/c1-28(2)15-5-3-4-14-26-22(29)20-18-10-11-19(24(18)12-13-24)21(20)23(30)27-17-8-6-16(25)7-9-17/h6-9,18-21H,3-5,10-15H2,1-2H3,(H,26,29)(H,27,30)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | CAVHAXDNOMXDSP-PLACYPQZSA-N |
| XLogP | 4.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|