C26H25BrN2O2 — CID 67495804
(1S,2R,3R,4R)-N-(4-bromophenyl)-3-[(3-phenylprop-2-enoylamino)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 67495804) has the molecular formula C26H25BrN2O2 and a molecular weight of 477.40 g/mol. Its IUPAC name is (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[(3-phenylprop-2-enoylamino)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[(3-phenylprop-2-enoylamino)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 67495804 |
| Molecular Formula | C26H25BrN2O2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[(3-phenylprop-2-enoylamino)methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | O=C(C=Cc1ccccc1)NC[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C26H25BrN2O2/c27-18-7-9-19(10-8-18)29-25(31)24-20(21-11-12-22(24)26(21)14-15-26)16-28-23(30)13-6-17-4-2-1-3-5-17/h1-13,20-22,24H,14-16H2,(H,28,30)(H,29,31)/t20-,21-,22+,24+/m1/s1 |
| InChIKey | BBIBBQRTCFIGSO-SVPADUAOSA-N |
| XLogP | 5.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|