C22H25BrN2O3 — CID 67495824
(1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(oxolan-2-ylmethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495824) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(oxolan-2-ylmethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(oxolan-2-ylmethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495824 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(oxolan-2-ylmethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C22H25BrN2O3/c23-13-3-5-14(6-4-13)25-21(27)19-17-8-7-16(22(17)9-10-22)18(19)20(26)24-12-15-2-1-11-28-15/h3-8,15-19H,1-2,9-12H2,(H,24,26)(H,25,27)/t15?,16-,17+,18-,19-/m1/s1 |
| InChIKey | IVRUXPYIWXKXHV-BMSWRWNDSA-N |
| XLogP | 3.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|