C17H25N3O2 — CID 67495948
(1S,4R)-3-N-(1-methylpiperidin-4-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495948) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (1S,4R)-3-N-(1-methylpiperidin-4-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,4R)-3-N-(1-methylpiperidin-4-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495948 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (1S,4R)-3-N-(1-methylpiperidin-4-yl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CN1CCC(NC(=O)C2C(C(N)=O)[C@@H]3C=C[C@H]2C32CC2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-20-8-4-10(5-9-20)19-16(22)14-12-3-2-11(13(14)15(18)21)17(12)6-7-17/h2-3,10-14H,4-9H2,1H3,(H2,18,21)(H,19,22)/t11-,12+,13?,14?/m0/s1 |
| InChIKey | WGZBYQBWUHILKO-MRFVTOPCSA-N |
| XLogP | 0.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|