C31H33F3N4O6 — CID 67495991
[(3R)-1-[3-(pyrazine-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67495991) has the molecular formula C31H33F3N4O6 and a molecular weight of 614.62 g/mol. Its IUPAC name is [(3R)-1-[3-(pyrazine-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[3-(pyrazine-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67495991 |
| Molecular Formula | C31H33F3N4O6 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | [(3R)-1-[3-(pyrazine-2-carbonylamino)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(NCCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)c1cnccn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H32N4O4.C2HF3O2/c34-27(25-20-30-15-16-31-25)32-14-7-17-33-18-12-22(13-19-33)26(21-33)37-28(35)29(36,23-8-3-1-4-9-23)24-10-5-2-6-11-24;3-2(4,5)1(6)7/h1-6,8-11,15-16,20,22,26,36H,7,12-14,17-19,21H2;(H,6,7)/t22?,26-,33?;/m0./s1 |
| InChIKey | ZQVOTFKHEVHKDJ-WWAPZXQFSA-N |
| XLogP | 1.98 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|