About 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate
2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 67496187) has the molecular formula C18H21BrFNO5
and a molecular weight of 430.27 g/mol. Its IUPAC name is 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 67496187 |
| Molecular Formula | C18H21BrFNO5 |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCC(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C18H21BrFNO5/c1-18(2,3)26-17(24)21-8-4-5-14(21)16(23)25-10-15(22)11-6-7-12(19)13(20)9-11/h6-7,9,14H,4-5,8,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | AIGZDJLDUBWOTL-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (CID 67496187) is 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCC(=O)c1ccc(Br)c(F)c1.
What is the InChIKey of 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate?
The InChIKey is AIGZDJLDUBWOTL-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H21BrFNO5/c1-18(2,3)26-17(24)21-8-4-5-14(21)16(23)25-10-15(22)11-6-7-12(19)13(20)9-11/h6-7,9,14H,4-5,8,10H2,1-3H3/t14-/m0/s1.
What are the key properties of 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate?
2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate has a molecular weight of 430.27 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-(4-bromo-3-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 67496187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).