C20H26N4O3S — CID 67496228
(1R,2R,3R,4S)-3-N-[(4-acetyl-1,3-thiazol-2-yl)methyl]-2-N-(3-aminopropyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67496228) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-[(4-acetyl-1,3-thiazol-2-yl)methyl]-2-N-(3-aminopropyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-[(4-acetyl-1,3-thiazol-2-yl)methyl]-2-N-(3-aminopropyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67496228 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-[(4-acetyl-1,3-thiazol-2-yl)methyl]-2-N-(3-aminopropyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CC(=O)c1csc(CNC(=O)[C@H]2[C@H](C(=O)NCCCN)[C@H]3C=C[C@@H]2C32CC2)n1 |
| InChI | InChI=1S/C20H26N4O3S/c1-11(25)14-10-28-15(24-14)9-23-19(27)17-13-4-3-12(20(13)5-6-20)16(17)18(26)22-8-2-7-21/h3-4,10,12-13,16-17H,2,5-9,21H2,1H3,(H,22,26)(H,23,27)/t12-,13+,16-,17-/m1/s1 |
| InChIKey | FGWWXEDBWIHDGC-DLTLXFJOSA-N |
| XLogP | 1.26 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|