C37H38F3N3O6 — CID 67496303
[(3R)-1-[3-[(4-pyrrol-1-ylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate (PubChem CID 67496303) has the molecular formula C37H38F3N3O6 and a molecular weight of 677.72 g/mol. Its IUPAC name is [(3R)-1-[3-[(4-pyrrol-1-ylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[3-[(4-pyrrol-1-ylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67496303 |
| Molecular Formula | C37H38F3N3O6 |
| Molecular Weight | 677.72 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | [(3R)-1-[3-[(4-pyrrol-1-ylbenzoyl)amino]propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-diphenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(NCCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1ccccc1)c1ccccc1)C2)c1ccc(-n2cccc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C35H37N3O4.C2HF3O2/c39-33(28-14-16-31(17-15-28)37-21-7-8-22-37)36-20-9-23-38-24-18-27(19-25-38)32(26-38)42-34(40)35(41,29-10-3-1-4-11-29)30-12-5-2-6-13-30;3-2(4,5)1(6)7/h1-8,10-17,21-22,27,32,41H,9,18-20,23-26H2;(H,6,7)/t27?,32-,38?;/m0./s1 |
| InChIKey | OOVPCIYIJQRQCR-MOGMCNDHSA-N |
| XLogP | 3.98 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|