C39H54N2O8S — CID 67496834
4-[(3S,4R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butan-2-ol (PubChem CID 67496834) has the molecular formula C39H54N2O8S and a molecular weight of 710.93 g/mol. Its IUPAC name is 4-[(3S,4R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butan-2-ol.
| Compound Name | 4-[(3S,4R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butan-2-ol |
|---|---|
| PubChem CID | 67496834 |
| Molecular Formula | C39H54N2O8S |
| Molecular Weight | 710.93 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | 4-[(3S,4R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-yl]butan-2-ol |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(S(=O)(=O)c4ccc(C)cc4)C[C@@H](CCC(C)O)[C@@H]3c3ccc(COCCOC)cc3)cc21 |
| InChI | InChI=1S/C39H54N2O8S/c1-29-6-15-35(16-7-29)50(43,44)41-25-34(12-8-30(2)42)39(33-13-9-31(10-14-33)27-47-23-22-46-4)38(26-41)49-28-32-11-17-37-36(24-32)40(19-21-48-37)18-5-20-45-3/h6-7,9-11,13-17,24,30,34,38-39,42H,5,8,12,18-23,25-28H2,1-4H3/t30?,34-,38+,39+/m1/s1 |
| InChIKey | QCLDIXXWNSQWPH-MVGPMZGWSA-N |
| XLogP | 5.54 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.93 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|