C30H35F3O3S — CID 67497762
(Z)-3-[4-[3,5-bis(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid (PubChem CID 67497762) has the molecular formula C30H35F3O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is (Z)-3-[4-[3,5-bis(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid.
| Compound Name | (Z)-3-[4-[3,5-bis(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 67497762 |
| Molecular Formula | C30H35F3O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (Z)-3-[4-[3,5-bis(2-methylbutan-2-yl)-2-(2,2,2-trifluoroethoxy)phenyl]-1-benzothiophen-2-yl]but-2-enoic acid |
| SMILES | CCC(C)(C)c1cc(-c2cccc3sc(/C(C)=C\C(=O)O)cc23)c(OCC(F)(F)F)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C30H35F3O3S/c1-8-28(4,5)19-14-22(27(36-17-30(31,32)33)23(15-19)29(6,7)9-2)20-11-10-12-24-21(20)16-25(37-24)18(3)13-26(34)35/h10-16H,8-9,17H2,1-7H3,(H,34,35)/b18-13- |
| InChIKey | ZFMYXJWXPRRCGR-AQTBWJFISA-N |
| XLogP | 9.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|