About 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol
4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol (PubChem CID 67498252) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol |
| PubChem CID | 67498252 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(CO)cc(CC=C)c1O |
| InChI | InChI=1S/C13H16O2/c1-3-5-11-7-10(9-14)8-12(6-4-2)13(11)15/h3-4,7-8,14-15H,1-2,5-6,9H2 |
| InChIKey | OQYVCXNDVHIJNH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol?
The IUPAC name of 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol (CID 67498252) is 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol.
What is the SMILES notation for 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol?
The canonical SMILES for 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol is C=CCc1cc(CO)cc(CC=C)c1O.
What is the InChIKey of 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol?
The InChIKey is OQYVCXNDVHIJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-3-5-11-7-10(9-14)8-12(6-4-2)13(11)15/h3-4,7-8,14-15H,1-2,5-6,9H2.
What are the key properties of 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol?
4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol has a molecular weight of 204.27 g/mol, XLogP of 2.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,6-bis(prop-2-enyl)phenol is sourced from PubChem (CID 67498252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).