About 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane
2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane (PubChem CID 67498638) has the molecular formula C26H26N2Si
and a molecular weight of 394.59 g/mol. Its IUPAC name is 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane |
| PubChem CID | 67498638 |
| Molecular Formula | C26H26N2Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc(C2=CC(c3ccccc3)N(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C26H26N2Si/c1-29(2,3)19-18-21-14-16-22(17-15-21)25-20-26(23-10-6-4-7-11-23)28(27-25)24-12-8-5-9-13-24/h4-17,20,26-27H,1-3H3 |
| InChIKey | XLYSYERHJMOJPO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane?
The IUPAC name of 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane (CID 67498638) is 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane is C[Si](C)(C)C#Cc1ccc(C2=CC(c3ccccc3)N(c3ccccc3)N2)cc1.
What is the InChIKey of 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane?
The InChIKey is XLYSYERHJMOJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2Si/c1-29(2,3)19-18-21-14-16-22(17-15-21)25-20-26(23-10-6-4-7-11-23)28(27-25)24-12-8-5-9-13-24/h4-17,20,26-27H,1-3H3.
What are the key properties of 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane?
2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane has a molecular weight of 394.59 g/mol, XLogP of 6.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-diphenyl-1,3-dihydropyrazol-5-yl)phenyl]ethynyl-trimethylsilane is sourced from PubChem (CID 67498638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).