C27H31FN10OSi — CID 67498684
2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67498684) has the molecular formula C27H31FN10OSi and a molecular weight of 558.70 g/mol. Its IUPAC name is 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67498684 |
| Molecular Formula | C27H31FN10OSi |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1c2nncn2-c2cnc(-n3ccnc3-c3ccc(F)cc3)nc2N1c1cnn(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C27H31FN10OSi/c1-5-22-26-34-31-17-37(26)23-15-30-27(36-11-10-29-24(36)19-6-8-20(28)9-7-19)33-25(23)38(22)21-14-32-35(16-21)18-39-12-13-40(2,3)4/h6-11,14-17,22H,5,12-13,18H2,1-4H3 |
| InChIKey | DSLRXRNOOSUYJI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|