C12H9ClF3N3O2 — CID 67498710
[1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-methylcarbamic acid (PubChem CID 67498710) has the molecular formula C12H9ClF3N3O2 and a molecular weight of 319.67 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-methylcarbamic acid.
| Compound Name | [1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67498710 |
| Molecular Formula | C12H9ClF3N3O2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | [1-(3-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(C(F)(F)F)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H9ClF3N3O2/c1-18(11(20)21)10-6-9(12(14,15)16)17-19(10)8-4-2-3-7(13)5-8/h2-6H,1H3,(H,20,21) |
| InChIKey | ISIKBNXDSQTOLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |