About 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one
7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 67498830) has the molecular formula C10H8N2OS
and a molecular weight of 204.25 g/mol. Its IUPAC name is 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 67498830 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2sc3c(c12)C=CCC3 |
| InChI | InChI=1S/C10H8N2OS/c13-9-8-6-3-1-2-4-7(6)14-10(8)12-5-11-9/h1,3,5H,2,4H2,(H,11,12,13) |
| InChIKey | SNZYWXLYHOMQIW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CID 67498830) is 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one is O=c1[nH]cnc2sc3c(c12)C=CCC3.
What is the InChIKey of 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one?
The InChIKey is SNZYWXLYHOMQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS/c13-9-8-6-3-1-2-4-7(6)14-10(8)12-5-11-9/h1,3,5H,2,4H2,(H,11,12,13).
What are the key properties of 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one?
7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one has a molecular weight of 204.25 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 67498830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).