About trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one
trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one (PubChem CID 67498887) has the molecular formula C13H24O3Si
and a molecular weight of 256.42 g/mol. Its IUPAC name is trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one |
| PubChem CID | 67498887 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one |
| SMILES | C=C1[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-9-11(15)7-10(14)8-12(9)16-17(5,6)13(2,3)4/h11-12,15H,1,7-8H2,2-6H3/t11-,12-/m1/s1 |
| InChIKey | RXTFEQIDMIOTRD-VXGBXAGGSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one?
The IUPAC name of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one (CID 67498887) is trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one.
What is the SMILES notation for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one?
The canonical SMILES for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one is C=C1[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one?
The InChIKey is RXTFEQIDMIOTRD-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H24O3Si/c1-9-11(15)7-10(14)8-12(9)16-17(5,6)13(2,3)4/h11-12,15H,1,7-8H2,2-6H3/t11-,12-/m1/s1.
What are the key properties of trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one?
trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one has a molecular weight of 256.42 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-methylidenecyclohexan-1-one is sourced from PubChem (CID 67498887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).