C20H21N9S — CID 67499077
2-[4-[(4R)-9-(1-cyclopropylethyl)-4-ethyl-4,5-dihydro-[1,2,4]triazolo[4,3-f]pteridin-7-yl]-1H-pyrazol-5-yl]-1,3-thiazole (PubChem CID 67499077) has the molecular formula C20H21N9S and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[4-[(4R)-9-(1-cyclopropylethyl)-4-ethyl-4,5-dihydro-[1,2,4]triazolo[4,3-f]pteridin-7-yl]-1H-pyrazol-5-yl]-1,3-thiazole.
| Compound Name | 2-[4-[(4R)-9-(1-cyclopropylethyl)-4-ethyl-4,5-dihydro-[1,2,4]triazolo[4,3-f]pteridin-7-yl]-1H-pyrazol-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 67499077 |
| Molecular Formula | C20H21N9S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[4-[(4R)-9-(1-cyclopropylethyl)-4-ethyl-4,5-dihydro-[1,2,4]triazolo[4,3-f]pteridin-7-yl]-1H-pyrazol-5-yl]-1,3-thiazole |
| SMILES | CC[C@H]1Nc2nc(-c3cn[nH]c3-c3nccs3)nc(C(C)C3CC3)c2-n2cnnc21 |
| InChI | InChI=1S/C20H21N9S/c1-3-13-19-28-23-9-29(19)16-14(10(2)11-4-5-11)25-17(26-18(16)24-13)12-8-22-27-15(12)20-21-6-7-30-20/h6-11,13H,3-5H2,1-2H3,(H,22,27)(H,24,25,26)/t10?,13-/m1/s1 |
| InChIKey | XYZRYLXVXPQFMN-JLOHTSLTSA-N |
| XLogP | 3.96 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |