C11H20ClNO — CID 67499232
1-[(2R,6S)-6-methylpiperidin-2-yl]pent-4-en-1-one;hydrochloride (PubChem CID 67499232) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 1-[(2R,6S)-6-methylpiperidin-2-yl]pent-4-en-1-one;hydrochloride.
| Compound Name | 1-[(2R,6S)-6-methylpiperidin-2-yl]pent-4-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 67499232 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-[(2R,6S)-6-methylpiperidin-2-yl]pent-4-en-1-one;hydrochloride |
| SMILES | C=CCCC(=O)[C@H]1CCC[C@H](C)N1.Cl |
| InChI | InChI=1S/C11H19NO.ClH/c1-3-4-8-11(13)10-7-5-6-9(2)12-10;/h3,9-10,12H,1,4-8H2,2H3;1H/t9-,10+;/m0./s1 |
| InChIKey | PLNUKCYSVHBWAK-BAUSSPIASA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|