C19H36O3 — CID 67499443
(7R)-1-[1-(3-ethyl-3-hydroxypentoxy)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol (PubChem CID 67499443) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (7R)-1-[1-(3-ethyl-3-hydroxypentoxy)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol.
| Compound Name | (7R)-1-[1-(3-ethyl-3-hydroxypentoxy)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 67499443 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (7R)-1-[1-(3-ethyl-3-hydroxypentoxy)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol |
| SMILES | CCC(O)(CC)CCOC(C)C1CCC2C(O)CCC(C)C21 |
| InChI | InChI=1S/C19H36O3/c1-5-19(21,6-2)11-12-22-14(4)15-8-9-16-17(20)10-7-13(3)18(15)16/h13-18,20-21H,5-12H2,1-4H3 |
| InChIKey | UMILYLJPGWVCNA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |