C28H33FN10OSi — CID 67499599
2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67499599) has the molecular formula C28H33FN10OSi and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67499599 |
| Molecular Formula | C28H33FN10OSi |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 2-[[4-[4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-5-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC1c2nnc(C)n2-c2cnc(-n3ccnc3-c3ccc(F)cc3)nc2N1c1cnn(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C28H33FN10OSi/c1-6-23-27-35-34-19(2)38(27)24-16-31-28(37-12-11-30-25(37)20-7-9-21(29)10-8-20)33-26(24)39(23)22-15-32-36(17-22)18-40-13-14-41(3,4)5/h7-12,15-17,23H,6,13-14,18H2,1-5H3 |
| InChIKey | RNFGLJLYNGDTOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|