About 2-methyl-3H-1,2-thiazole-5-carboxamide
2-methyl-3H-1,2-thiazole-5-carboxamide (PubChem CID 67500411) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is 2-methyl-3H-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-3H-1,2-thiazole-5-carboxamide |
| PubChem CID | 67500411 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-methyl-3H-1,2-thiazole-5-carboxamide |
| SMILES | CN1CC=C(C(N)=O)S1 |
| InChI | InChI=1S/C5H8N2OS/c1-7-3-2-4(9-7)5(6)8/h2H,3H2,1H3,(H2,6,8) |
| InChIKey | HBLXJKIFEUWZIZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3H-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-1,2-thiazole-5-carboxamide?
The IUPAC name of 2-methyl-3H-1,2-thiazole-5-carboxamide (CID 67500411) is 2-methyl-3H-1,2-thiazole-5-carboxamide.
What is the SMILES notation for 2-methyl-3H-1,2-thiazole-5-carboxamide?
The canonical SMILES for 2-methyl-3H-1,2-thiazole-5-carboxamide is CN1CC=C(C(N)=O)S1.
What is the InChIKey of 2-methyl-3H-1,2-thiazole-5-carboxamide?
The InChIKey is HBLXJKIFEUWZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS/c1-7-3-2-4(9-7)5(6)8/h2H,3H2,1H3,(H2,6,8).
What are the key properties of 2-methyl-3H-1,2-thiazole-5-carboxamide?
2-methyl-3H-1,2-thiazole-5-carboxamide has a molecular weight of 144.20 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 67500411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).