C40H70O3Sn2 — CID 67501540
dibutyl-[dibutyl-(2-methyl-3-pentylphenoxy)stannyl]oxy-(2-methyl-3-pentylphenoxy)stannane (PubChem CID 67501540) has the molecular formula C40H70O3Sn2 and a molecular weight of 836.42 g/mol. Its IUPAC name is dibutyl-[dibutyl-(2-methyl-3-pentylphenoxy)stannyl]oxy-(2-methyl-3-pentylphenoxy)stannane.
| Compound Name | dibutyl-[dibutyl-(2-methyl-3-pentylphenoxy)stannyl]oxy-(2-methyl-3-pentylphenoxy)stannane |
|---|---|
| PubChem CID | 67501540 |
| Molecular Formula | C40H70O3Sn2 |
| Molecular Weight | 836.42 g/mol |
| Exact Mass | 838.34 |
| IUPAC Name | dibutyl-[dibutyl-(2-methyl-3-pentylphenoxy)stannyl]oxy-(2-methyl-3-pentylphenoxy)stannane |
| SMILES | CCCCCc1cccc(O[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)Oc2cccc(CCCCC)c2C)c1C |
| InChI | InChI=1S/2C12H18O.4C4H9.O.2Sn/c2*1-3-4-5-7-11-8-6-9-12(13)10(11)2;4*1-3-4-2;;;/h2*6,8-9,13H,3-5,7H2,1-2H3;4*1,3-4H2,2H3;;;/q;;;;;;;2*+1/p-2 |
| InChIKey | ZHRYFPGTMSSVFP-UHFFFAOYSA-L |
| XLogP | 13.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.42 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|